Methoxybenzoic acids and derivatives
Medchemexpress LLC Ethyl hydrogen malonate | 1071-46-1 | MFCD00020490 | ≥96.0% | 132.11 g/mol | C5H8O4 | 25g
3-Ethoxy-3-oxopropanoic acid is an endogenous metabolite 3-Ethoxy-3-oxopropanoic acid promotes plant growth[1]
Apexbio Technology LLC 5-Methoxy-UTP 10ul (100 mM)
5-Methoxy-UTP is a modified uridine triphosphate nucleotide bearing a methoxy group at the carbon-5 position This modification significantly alters the chemical properties and biological functions of the nucleotide During in vitro mRNA synthesis 5-Methoxy-UTP can be incorporated into RNA molecules generating RNAs containing 5-methoxyuridine residues Methoxy-modified RNA plays an important role in studies focusing on RNA structure function and interactions with proteins Additionally 5-Methoxy-UTP markedly improves RNA stability and protects against intracellular degradation Therefore this modification is widely utilized in gene expression research RNA drug development and gene therapy applications
Medchemexpress LLC (S)-5-Methoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride | 93601-86-6 | 99.99% | 255.78 | 10 G
(S)-5-Methoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride is a chemical compound primarily used as a drug intermediate. It is essential for the synthesis of various active pharmaceutical compounds.
- Drug intermediate for synthesis of active compounds.
Medchemexpress LLC 2-Hydroxy-4-methoxyb 100g
2-Hydroxy-4-methoxybenzoic acid (potassium) is one of the major phytoconstituents of Decalepis arayalpathra also known as 4-Methoxysalicylic acid (potassium) has a variety of biological effects including anti-inflammatory antipyretic antioxidant and anti-diabetic properties[1]
eMolecules 2150-38-1 | Methyl 3,4-dimethoxybenzoate | Combi-Blocks | MFCD00008430 | 196.202 | C10H12O4 | 98.000 | COC(=O)c1ccc(OC)c(OC)c1 | 25g | 290688130
Methyl 3,4-dimethoxybenzoate | Combi-Blocks | 2150-38-1 | MFCD00008430 | 196.202 | C10H12O4 | 98.000 | COC(=O)c1ccc(OC)c(OC)c1 | 25g | 290688130
Medchemexpress LLC 2-acetyl-6-methoxynaphthalene | 3900-45-6 | MFCD00021643 | >98.0% | 200.23 g/mol | C13H12O2 | 10g
6 -Methoxy-2 -acetonaphthone is a biochemical reagent that can be used as a biological material or organic compound for life science related research
Aobchem 2-Ethoxy-1 3-difluoro-4-methylbenzene | 95% | CAS 1804412-99-4 | C9H10F2O | 250mg
2-Ethoxy-1 3-difluoro-4-methylbenzene | 95% | CAS 1804412-99-4 | C9H10F2O | 250mg
eMolecules 1629971-64-7 | 3-(Cyclopentyloxy)-2,4-difluorophenylboronic acid | Combi-Blocks | MFCD19981516 | 242.030 | C11H13BF2O3 | 98.000 | OB(O)c1ccc(F)c(OC2CCCC2)c1F | 1g | 205381859
3-(Cyclopentyloxy)-2,4-difluorophenylboronic acid | Combi-Blocks | 1629971-64-7 | MFCD19981516 | 242.030 | C11H13BF2O3 | 98.000 | OB(O)c1ccc(F)c(OC2CCCC2)c1F | 1g | 205381859
Cambridge Isotope Laboratories 4-Methoxy-2 2 3 4 5 5-hexaCB (unlabeled) 50 ug/mL in nonane 1 2 mL
4-Methoxy-2 2 3 4 5 5-hexaCB (unlabeled) 50 ug/mL in nonane 1 2 mL
Aobchem 2-Chloro-3-ethoxy-5-fluorobenzaldehyde | 97% | CAS 2386261-30-7 | C9H8ClFO2 | 250mg
2-Chloro-3-ethoxy-5-fluorobenzaldehyde | 97% | CAS 2386261-30-7 | C9H8ClFO2 | 250mg
Aobchem 4-Chloro-1-ethyl-2-methoxybenzene | 97% | CAS 1369936-07-1 | C9H11ClO | 1g
4-Chloro-1-ethyl-2-methoxybenzene | 97% | CAS 1369936-07-1 | C9H11ClO | 1g
Aobchem 2-Methoxy-5-phenoxybenzaldehyde | 97% | CAS 63987-39-3 | C14H12O3 | 500mg
2-Methoxy-5-phenoxybenzaldehyde | 97% | CAS 63987-39-3 | C14H12O3 | 500mg
Aobchem 1-(3-Chloro-2-(cyclopentyloxy)pyridin-4-yl)ethanone | 95% | C12H14ClNO2 | 1g
1-(3-Chloro-2-(cyclopentyloxy)pyridin-4-yl)ethanone | 95% | C12H14ClNO2 | 1g
Aobchem 3-Ethoxy-2 4 6-trifluorobenzoic acid | 97% | CAS 2807448-09-3 | C9H7F3O3 | 500mg
3-Ethoxy-2 4 6-trifluorobenzoic acid | 97% | CAS 2807448-09-3 | C9H7F3O3 | 500mg
Aobchem 2 2-Difluoro-1-(2-methoxy-4-(trifluoromethyl)phenyl)ethanone | 95% | CAS 2352654-24-9 | C10H7F5O2 | 250mg
2 2-Difluoro-1-(2-methoxy-4-(trifluoromethyl)phenyl)ethanone | 95% | CAS 2352654-24-9 | C10H7F5O2 | 250mg